ChemNet > CAS > 225104-76-7 3-Chloro-2,6-difluorobenzoic acid
225104-76-7 3-Chloro-2,6-difluorobenzoic acid
| اسم المنتج |
3-Chloro-2,6-difluorobenzoic acid |
| الصيغة الجزيئية |
C7H3ClF2O2 |
| الوزن الجزيئي الغرامي |
192.5473 |
| InChI |
InChI=1/C7H3ClF2O2/c8-3-1-2-4(9)5(6(3)10)7(11)12/h1-2H,(H,11,12) |
| إستراتيجية المساعدة القطرية |
225104-76-7 |
| بنية جزيئية |
|
| كثافة |
1.573g/cm3 |
| نقطة الغليان |
264.5°C at 760 mmHg |
| معامل الإنكسار |
1.534 |
| نقطة الوميض |
113.8°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
